C16H34N6O6 — CID 158264898
bis((2S)-2,6-diaminohexanoic acid);piperazine-2,3-dione (PubChem CID 158264898) has the molecular formula C16H34N6O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is bis((2S)-2,6-diaminohexanoic acid);piperazine-2,3-dione.
| Compound Name | bis((2S)-2,6-diaminohexanoic acid);piperazine-2,3-dione |
|---|---|
| PubChem CID | 158264898 |
| Molecular Formula | C16H34N6O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | bis((2S)-2,6-diaminohexanoic acid);piperazine-2,3-dione |
| SMILES | NCCCC[C@H](N)C(=O)O.NCCCC[C@H](N)C(=O)O.O=C1NCCNC1=O |
| InChI | InChI=1S/2C6H14N2O2.C4H6N2O2/c2*7-4-2-1-3-5(8)6(9)10;7-3-4(8)6-2-1-5-3/h2*5H,1-4,7-8H2,(H,9,10);1-2H2,(H,5,7)(H,6,8)/t2*5-;/m00./s1 |
| InChIKey | GIHXFGWCRXWLBP-MDTVQASCSA-N |
| XLogP | -2.71 |
| TPSA | 236.88 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|