C12H25N5O6 — CID 175430973
2-aminoacetic acid;2,6-diaminohexanoic acid;piperazine-2,3-dione (PubChem CID 175430973) has the molecular formula C12H25N5O6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-aminoacetic acid;2,6-diaminohexanoic acid;piperazine-2,3-dione.
| Compound Name | 2-aminoacetic acid;2,6-diaminohexanoic acid;piperazine-2,3-dione |
|---|---|
| PubChem CID | 175430973 |
| Molecular Formula | C12H25N5O6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-aminoacetic acid;2,6-diaminohexanoic acid;piperazine-2,3-dione |
| SMILES | NCC(=O)O.NCCCCC(N)C(=O)O.O=C1NCCNC1=O |
| InChI | InChI=1S/C6H14N2O2.C4H6N2O2.C2H5NO2/c7-4-2-1-3-5(8)6(9)10;7-3-4(8)6-2-1-5-3;3-1-2(4)5/h5H,1-4,7-8H2,(H,9,10);1-2H2,(H,5,7)(H,6,8);1,3H2,(H,4,5) |
| InChIKey | IYGHZVOICQDAGZ-UHFFFAOYSA-N |
| XLogP | -3.21 |
| TPSA | 210.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|