C12H22N4O8 — CID 174776175
2-aminopentanedioic acid;2-aminopropanoic acid;piperazine-2,3-dione (PubChem CID 174776175) has the molecular formula C12H22N4O8 and a molecular weight of 350.33 g/mol. Its IUPAC name is 2-aminopentanedioic acid;2-aminopropanoic acid;piperazine-2,3-dione.
| Compound Name | 2-aminopentanedioic acid;2-aminopropanoic acid;piperazine-2,3-dione |
|---|---|
| PubChem CID | 174776175 |
| Molecular Formula | C12H22N4O8 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-aminopentanedioic acid;2-aminopropanoic acid;piperazine-2,3-dione |
| SMILES | CC(N)C(=O)O.NC(CCC(=O)O)C(=O)O.O=C1NCCNC1=O |
| InChI | InChI=1S/C5H9NO4.C4H6N2O2.C3H7NO2/c6-3(5(9)10)1-2-4(7)8;7-3-4(8)6-2-1-5-3;1-2(4)3(5)6/h3H,1-2,6H2,(H,7,8)(H,9,10);1-2H2,(H,5,7)(H,6,8);2H,4H2,1H3,(H,5,6) |
| InChIKey | UFZYEWDIWYDPAR-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 222.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|