C8H18Cl2N2O5 — CID 161206494
2-amino-4-hydroxybutanoic acid;3-aminooxolan-2-one;dihydrochloride (PubChem CID 161206494) has the molecular formula C8H18Cl2N2O5 and a molecular weight of 293.15 g/mol. Its IUPAC name is 2-amino-4-hydroxybutanoic acid;3-aminooxolan-2-one;dihydrochloride.
| Compound Name | 2-amino-4-hydroxybutanoic acid;3-aminooxolan-2-one;dihydrochloride |
|---|---|
| PubChem CID | 161206494 |
| Molecular Formula | C8H18Cl2N2O5 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-amino-4-hydroxybutanoic acid;3-aminooxolan-2-one;dihydrochloride |
| SMILES | Cl.Cl.NC(CCO)C(=O)O.NC1CCOC1=O |
| InChI | InChI=1S/C4H9NO3.C4H7NO2.2ClH/c5-3(1-2-6)4(7)8;5-3-1-2-7-4(3)6;;/h3,6H,1-2,5H2,(H,7,8);3H,1-2,5H2;2*1H |
| InChIKey | FOLITBBTKGFHHS-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |