C12H19NO2 — CID 155132308
cyclohexa-1,5-dien-1-ylmethyl N-(2-methylpropyl)carbamate (PubChem CID 155132308) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl N-(2-methylpropyl)carbamate.
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 155132308 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl N-(2-methylpropyl)carbamate |
| SMILES | CC(C)CNC(=O)OCC1=CCCC=C1 |
| InChI | InChI=1S/C12H19NO2/c1-10(2)8-13-12(14)15-9-11-6-4-3-5-7-11/h4,6-7,10H,3,5,8-9H2,1-2H3,(H,13,14) |
| InChIKey | UYKLMJGOPJBPFJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |