About (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate
(3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate (PubChem CID 91305946) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate.
Molecular Properties
| Compound Name | (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate |
| PubChem CID | 91305946 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate |
| SMILES | CCc1cc(COC(=O)NCC(C)C)on1 |
| InChI | InChI=1S/C11H18N2O3/c1-4-9-5-10(16-13-9)7-15-11(14)12-6-8(2)3/h5,8H,4,6-7H2,1-3H3,(H,12,14) |
| InChIKey | HGYSBTSOGIDPBB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate?
The IUPAC name of (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate (CID 91305946) is (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate.
What is the SMILES notation for (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate?
The canonical SMILES for (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate is CCc1cc(COC(=O)NCC(C)C)on1.
What is the InChIKey of (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate?
The InChIKey is HGYSBTSOGIDPBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-4-9-5-10(16-13-9)7-15-11(14)12-6-8(2)3/h5,8H,4,6-7H2,1-3H3,(H,12,14).
What are the key properties of (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate?
(3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate has a molecular weight of 226.28 g/mol, XLogP of 2.12, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate is sourced from PubChem (CID 91305946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).