About (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate
(3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate (PubChem CID 91305946) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate.
Analyze (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate?
The IUPAC name of (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate (CID 91305946) is (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate.
What is the SMILES notation for (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate?
The canonical SMILES for (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate is CCc1cc(COC(=O)NCC(C)C)on1.
What is the InChIKey of (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate?
The InChIKey is HGYSBTSOGIDPBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-4-9-5-10(16-13-9)7-15-11(14)12-6-8(2)3/h5,8H,4,6-7H2,1-3H3,(H,12,14).
What are the key properties of (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate?
(3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate has a molecular weight of 226.28 g/mol, XLogP of 2.12, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-1,2-oxazol-5-yl)methyl N-(2-methylpropyl)carbamate is sourced from PubChem (CID 91305946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).