About (2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide
(2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide (PubChem CID 95144078) has the molecular formula C17H23N3O2
and a molecular weight of 301.39 g/mol. Its IUPAC name is (2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide.
Molecular Properties
| Compound Name | (2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide |
| PubChem CID | 95144078 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide |
| SMILES | CCc1cc(CN(C)[C@@H](CC)C(=O)Nc2ccccc2)on1 |
| InChI | InChI=1S/C17H23N3O2/c1-4-13-11-15(22-19-13)12-20(3)16(5-2)17(21)18-14-9-7-6-8-10-14/h6-11,16H,4-5,12H2,1-3H3,(H,18,21)/t16-/m0/s1 |
| InChIKey | DRASEBSHQKSRCQ-INIZCTEOSA-N |
| XLogP | 3.09 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide?
The IUPAC name of (2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide (CID 95144078) is (2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide.
What is the SMILES notation for (2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide?
The canonical SMILES for (2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide is CCc1cc(CN(C)[C@@H](CC)C(=O)Nc2ccccc2)on1.
What is the InChIKey of (2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide?
The InChIKey is DRASEBSHQKSRCQ-INIZCTEOSA-N. The full InChI is InChI=1S/C17H23N3O2/c1-4-13-11-15(22-19-13)12-20(3)16(5-2)17(21)18-14-9-7-6-8-10-14/h6-11,16H,4-5,12H2,1-3H3,(H,18,21)/t16-/m0/s1.
What are the key properties of (2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide?
(2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide has a molecular weight of 301.39 g/mol, XLogP of 3.09, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(3-ethyl-1,2-oxazol-5-yl)methyl-methylamino]-N-phenylbutanamide is sourced from PubChem (CID 95144078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).