About 3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid
3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid (PubChem CID 83828594) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid |
| PubChem CID | 83828594 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid |
| SMILES | CCc1cc(CC(C)C(=O)O)no1 |
| InChI | InChI=1S/C9H13NO3/c1-3-8-5-7(10-13-8)4-6(2)9(11)12/h5-6H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | SBBGSCUUPVAAJC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid?
The IUPAC name of 3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid (CID 83828594) is 3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid?
The canonical SMILES for 3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid is CCc1cc(CC(C)C(=O)O)no1.
What is the InChIKey of 3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid?
The InChIKey is SBBGSCUUPVAAJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-3-8-5-7(10-13-8)4-6(2)9(11)12/h5-6H,3-4H2,1-2H3,(H,11,12).
What are the key properties of 3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid?
3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid has a molecular weight of 183.21 g/mol, XLogP of 1.50, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-ethyl-1,2-oxazol-3-yl)-2-methylpropanoic acid is sourced from PubChem (CID 83828594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).