C15H24NO7P — CID 123720732
methyl 2-(cyclohexa-1,5-dien-1-ylmethoxycarbonylamino)-2-diethoxyphosphorylacetate (PubChem CID 123720732) has the molecular formula C15H24NO7P and a molecular weight of 361.33 g/mol. Its IUPAC name is methyl 2-(cyclohexa-1,5-dien-1-ylmethoxycarbonylamino)-2-diethoxyphosphorylacetate.
| Compound Name | methyl 2-(cyclohexa-1,5-dien-1-ylmethoxycarbonylamino)-2-diethoxyphosphorylacetate |
|---|---|
| PubChem CID | 123720732 |
| Molecular Formula | C15H24NO7P |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | methyl 2-(cyclohexa-1,5-dien-1-ylmethoxycarbonylamino)-2-diethoxyphosphorylacetate |
| SMILES | CCOP(=O)(OCC)C(NC(=O)OCC1=CCCC=C1)C(=O)OC |
| InChI | InChI=1S/C15H24NO7P/c1-4-22-24(19,23-5-2)13(14(17)20-3)16-15(18)21-11-12-9-7-6-8-10-12/h7,9-10,13H,4-6,8,11H2,1-3H3,(H,16,18) |
| InChIKey | FOXWVGYKCWDUAM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|