C20H24N2O3 — CID 70673934
benzyl (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylate (PubChem CID 70673934) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is benzyl (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylate.
| Compound Name | benzyl (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 70673934 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | benzyl (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1CC[C@@H](NOCc2ccccc2)CN1 |
| InChI | InChI=1S/C20H24N2O3/c23-20(24-14-16-7-3-1-4-8-16)19-12-11-18(13-21-19)22-25-15-17-9-5-2-6-10-17/h1-10,18-19,21-22H,11-15H2/t18-,19+/m1/s1 |
| InChIKey | SHMFBKYBBMGQSQ-MOPGFXCFSA-N |
| XLogP | 2.57 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|