C16H20N2O6 — CID 175024507
1-O-methyl 2-O-[(2S,5R)-5-(phenylmethoxyamino)piperidine-2-carbonyl] oxalate (PubChem CID 175024507) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is 1-O-methyl 2-O-[(2S,5R)-5-(phenylmethoxyamino)piperidine-2-carbonyl] oxalate.
| Compound Name | 1-O-methyl 2-O-[(2S,5R)-5-(phenylmethoxyamino)piperidine-2-carbonyl] oxalate |
|---|---|
| PubChem CID | 175024507 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-O-methyl 2-O-[(2S,5R)-5-(phenylmethoxyamino)piperidine-2-carbonyl] oxalate |
| SMILES | COC(=O)C(=O)OC(=O)[C@@H]1CC[C@@H](NOCc2ccccc2)CN1 |
| InChI | InChI=1S/C16H20N2O6/c1-22-15(20)16(21)24-14(19)13-8-7-12(9-17-13)18-23-10-11-5-3-2-4-6-11/h2-6,12-13,17-18H,7-10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | GHRQBVMOLQTASE-OLZOCXBDSA-N |
| XLogP | 0.07 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|