C13H20N2O7S — CID 130300136
(2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylic acid;sulfuric acid (PubChem CID 130300136) has the molecular formula C13H20N2O7S and a molecular weight of 348.38 g/mol. Its IUPAC name is (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylic acid;sulfuric acid.
| Compound Name | (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylic acid;sulfuric acid |
|---|---|
| PubChem CID | 130300136 |
| Molecular Formula | C13H20N2O7S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylic acid;sulfuric acid |
| SMILES | O=C(O)[C@@H]1CC[C@@H](NOCc2ccccc2)CN1.O=S(=O)(O)O |
| InChI | InChI=1S/C13H18N2O3.H2O4S/c16-13(17)12-7-6-11(8-14-12)15-18-9-10-4-2-1-3-5-10;1-5(2,3)4/h1-5,11-12,14-15H,6-9H2,(H,16,17);(H2,1,2,3,4)/t11-,12+;/m1./s1 |
| InChIKey | IJXOSFHHZWLISH-LYCTWNKOSA-N |
| XLogP | 0.26 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|