C28H34N4O8 — CID 175028202
bis[(2R,5R)-5-(phenylmethoxyamino)piperidine-2-carbonyl] oxalate (PubChem CID 175028202) has the molecular formula C28H34N4O8 and a molecular weight of 554.60 g/mol. Its IUPAC name is bis[(2R,5R)-5-(phenylmethoxyamino)piperidine-2-carbonyl] oxalate.
| Compound Name | bis[(2R,5R)-5-(phenylmethoxyamino)piperidine-2-carbonyl] oxalate |
|---|---|
| PubChem CID | 175028202 |
| Molecular Formula | C28H34N4O8 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | bis[(2R,5R)-5-(phenylmethoxyamino)piperidine-2-carbonyl] oxalate |
| SMILES | O=C(OC(=O)[C@H]1CC[C@@H](NOCc2ccccc2)CN1)C(=O)OC(=O)[C@H]1CC[C@@H](NOCc2ccccc2)CN1 |
| InChI | InChI=1S/C28H34N4O8/c33-25(23-13-11-21(15-29-23)31-37-17-19-7-3-1-4-8-19)39-27(35)28(36)40-26(34)24-14-12-22(16-30-24)32-38-18-20-9-5-2-6-10-20/h1-10,21-24,29-32H,11-18H2/t21-,22-,23-,24-/m1/s1 |
| InChIKey | MFKBBAFAUDJCMU-MOUTVQLLSA-N |
| XLogP | 0.81 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|