C22H26N2O7 — CID 174892097
oxalic acid;[phenyl-[5-(phenylmethoxyamino)piperidin-2-yl]methyl] formate (PubChem CID 174892097) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is oxalic acid;[phenyl-[5-(phenylmethoxyamino)piperidin-2-yl]methyl] formate.
| Compound Name | oxalic acid;[phenyl-[5-(phenylmethoxyamino)piperidin-2-yl]methyl] formate |
|---|---|
| PubChem CID | 174892097 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | oxalic acid;[phenyl-[5-(phenylmethoxyamino)piperidin-2-yl]methyl] formate |
| SMILES | O=C(O)C(=O)O.O=COC(c1ccccc1)C1CCC(NOCc2ccccc2)CN1 |
| InChI | InChI=1S/C20H24N2O3.C2H2O4/c23-15-24-20(17-9-5-2-6-10-17)19-12-11-18(13-21-19)22-25-14-16-7-3-1-4-8-16;3-1(4)2(5)6/h1-10,15,18-22H,11-14H2;(H,3,4)(H,5,6) |
| InChIKey | KSGFEGFZJMQIER-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|