C13H18N2O3 — CID 87217512
(2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylic acid (PubChem CID 87217512) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylic acid.
| Compound Name | (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 87217512 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC[C@@H](NOCc2ccccc2)CN1 |
| InChI | InChI=1S/C13H18N2O3/c16-13(17)12-7-6-11(8-14-12)15-18-9-10-4-2-1-3-5-10/h1-5,11-12,14-15H,6-9H2,(H,16,17)/t11-,12+/m1/s1 |
| InChIKey | CDZNTXLXEGFPLP-NEPJUHHUSA-N |
| XLogP | 0.91 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|