C13H21Cl2N3O2 — CID 156834463
(2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxamide;dihydrochloride (PubChem CID 156834463) has the molecular formula C13H21Cl2N3O2 and a molecular weight of 322.24 g/mol. Its IUPAC name is (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxamide;dihydrochloride.
| Compound Name | (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 156834463 |
| Molecular Formula | C13H21Cl2N3O2 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)[C@@H]1CC[C@@H](NOCc2ccccc2)CN1 |
| InChI | InChI=1S/C13H19N3O2.2ClH/c14-13(17)12-7-6-11(8-15-12)16-18-9-10-4-2-1-3-5-10;;/h1-5,11-12,15-16H,6-9H2,(H2,14,17);2*1H/t11-,12+;;/m1../s1 |
| InChIKey | VGUYCASYQTTXMS-QBKBNCOFSA-N |
| XLogP | 1.16 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|