C14H17NO2S — CID 143113229
N-benzyl-1-cyclohexa-1,5-dien-1-ylmethanesulfonamide (PubChem CID 143113229) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is N-benzyl-1-cyclohexa-1,5-dien-1-ylmethanesulfonamide.
| Compound Name | N-benzyl-1-cyclohexa-1,5-dien-1-ylmethanesulfonamide |
|---|---|
| PubChem CID | 143113229 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | N-benzyl-1-cyclohexa-1,5-dien-1-ylmethanesulfonamide |
| SMILES | O=S(=O)(CC1=CCCC=C1)NCc1ccccc1 |
| InChI | InChI=1S/C14H17NO2S/c16-18(17,12-14-9-5-2-6-10-14)15-11-13-7-3-1-4-8-13/h1,3-5,7-10,15H,2,6,11-12H2 |
| InChIKey | QCXOVJHNSULMDX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |