C23H27N3S — CID 142540596
3-[(benzylamino)methyl]-5-[(cyclohexa-1,5-dien-1-ylmethylamino)methyl]benzenecarbothioamide (PubChem CID 142540596) has the molecular formula C23H27N3S and a molecular weight of 377.56 g/mol. Its IUPAC name is 3-[(benzylamino)methyl]-5-[(cyclohexa-1,5-dien-1-ylmethylamino)methyl]benzenecarbothioamide.
| Compound Name | 3-[(benzylamino)methyl]-5-[(cyclohexa-1,5-dien-1-ylmethylamino)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 142540596 |
| Molecular Formula | C23H27N3S |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 3-[(benzylamino)methyl]-5-[(cyclohexa-1,5-dien-1-ylmethylamino)methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1cc(CNCC2=CCCC=C2)cc(CNCc2ccccc2)c1 |
| InChI | InChI=1S/C23H27N3S/c24-23(27)22-12-20(16-25-14-18-7-3-1-4-8-18)11-21(13-22)17-26-15-19-9-5-2-6-10-19/h1,3-5,7-13,25-26H,2,6,14-17H2,(H2,24,27) |
| InChIKey | DZOYXNOFHUBQEG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|