C17H26 — CID 143782404
cyclohexa-1,5-dien-1-ylmethylbenzene;ethane (PubChem CID 143782404) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethylbenzene;ethane.
| Compound Name | cyclohexa-1,5-dien-1-ylmethylbenzene;ethane |
|---|---|
| PubChem CID | 143782404 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethylbenzene;ethane |
| SMILES | C1=CC(Cc2ccccc2)=CCC1.CC.CC |
| InChI | InChI=1S/C13H14.2C2H6/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2*1-2/h1,3-5,7-10H,2,6,11H2;2*1-2H3 |
| InChIKey | PYHQPDAAMUUCGX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |