C20H20N2OS — CID 134396545
1-(cyclohexa-1,5-dien-1-ylmethyl)-3-(2-phenoxyphenyl)thiourea (PubChem CID 134396545) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethyl)-3-(2-phenoxyphenyl)thiourea.
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-3-(2-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 134396545 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-3-(2-phenoxyphenyl)thiourea |
| SMILES | S=C(NCC1=CCCC=C1)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C20H20N2OS/c24-20(21-15-16-9-3-1-4-10-16)22-18-13-7-8-14-19(18)23-17-11-5-2-6-12-17/h2-3,5-14H,1,4,15H2,(H2,21,22,24) |
| InChIKey | CDPBABADDWHSQH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|