C21H19N5S — CID 143503970
1-(cyclohexa-1,5-dien-1-ylmethyl)-3-(3-phenylpyrido[2,3-b]pyrazin-6-yl)thiourea (PubChem CID 143503970) has the molecular formula C21H19N5S and a molecular weight of 373.49 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethyl)-3-(3-phenylpyrido[2,3-b]pyrazin-6-yl)thiourea.
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-3-(3-phenylpyrido[2,3-b]pyrazin-6-yl)thiourea |
|---|---|
| PubChem CID | 143503970 |
| Molecular Formula | C21H19N5S |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-3-(3-phenylpyrido[2,3-b]pyrazin-6-yl)thiourea |
| SMILES | S=C(NCC1=CCCC=C1)Nc1ccc2ncc(-c3ccccc3)nc2n1 |
| InChI | InChI=1S/C21H19N5S/c27-21(23-13-15-7-3-1-4-8-15)26-19-12-11-17-20(25-19)24-18(14-22-17)16-9-5-2-6-10-16/h2-3,5-12,14H,1,4,13H2,(H2,23,24,25,26,27) |
| InChIKey | WCYDPRTYONXIIR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|