C18H19N5O2S2 — CID 88994479
4-[6-(pentylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]thiophene-2-carboxylic acid (PubChem CID 88994479) has the molecular formula C18H19N5O2S2 and a molecular weight of 401.52 g/mol. Its IUPAC name is 4-[6-(pentylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]thiophene-2-carboxylic acid.
| Compound Name | 4-[6-(pentylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 88994479 |
| Molecular Formula | C18H19N5O2S2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 4-[6-(pentylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]thiophene-2-carboxylic acid |
| SMILES | CCCCCNC(=S)Nc1ccc2ncc(-c3csc(C(=O)O)c3)nc2n1 |
| InChI | InChI=1S/C18H19N5O2S2/c1-2-3-4-7-19-18(26)23-15-6-5-12-16(22-15)21-13(9-20-12)11-8-14(17(24)25)27-10-11/h5-6,8-10H,2-4,7H2,1H3,(H,24,25)(H2,19,21,22,23,26) |
| InChIKey | MGLRQGFAYUFCNG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|