About 4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid
4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid (PubChem CID 16727365) has the molecular formula C18H20N5O4P
and a molecular weight of 401.36 g/mol. Its IUPAC name is 4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid.
Molecular Properties
| Compound Name | 4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid |
| PubChem CID | 16727365 |
| Molecular Formula | C18H20N5O4P |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid |
| SMILES | O=C(NCCCCP(=O)(O)O)Nc1ccc2ncc(-c3ccccc3)nc2n1 |
| InChI | InChI=1S/C18H20N5O4P/c24-18(19-10-4-5-11-28(25,26)27)23-16-9-8-14-17(22-16)21-15(12-20-14)13-6-2-1-3-7-13/h1-3,6-9,12H,4-5,10-11H2,(H2,25,26,27)(H2,19,21,22,23,24) |
| InChIKey | NIUCAGLPJXRKAW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid?
The IUPAC name of 4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid (CID 16727365) is 4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid.
What is the SMILES notation for 4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid?
The canonical SMILES for 4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid is O=C(NCCCCP(=O)(O)O)Nc1ccc2ncc(-c3ccccc3)nc2n1.
What is the InChIKey of 4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid?
The InChIKey is NIUCAGLPJXRKAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N5O4P/c24-18(19-10-4-5-11-28(25,26)27)23-16-9-8-14-17(22-16)21-15(12-20-14)13-6-2-1-3-7-13/h1-3,6-9,12H,4-5,10-11H2,(H2,25,26,27)(H2,19,21,22,23,24).
What are the key properties of 4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid?
4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid has a molecular weight of 401.36 g/mol, XLogP of 2.77, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]butylphosphonic acid is sourced from PubChem (CID 16727365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).