C24H26N6O — CID 118328024
1-[3-(6-aminocyclohexa-1,5-dien-1-yl)pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea (PubChem CID 118328024) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is 1-[3-(6-aminocyclohexa-1,5-dien-1-yl)pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea.
| Compound Name | 1-[3-(6-aminocyclohexa-1,5-dien-1-yl)pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 118328024 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 1-[3-(6-aminocyclohexa-1,5-dien-1-yl)pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea |
| SMILES | NC1=CCCC=C1c1cnc2ccc(NC(=O)NCCCCc3ccccc3)nc2n1 |
| InChI | InChI=1S/C24H26N6O/c25-19-12-5-4-11-18(19)21-16-27-20-13-14-22(29-23(20)28-21)30-24(31)26-15-7-6-10-17-8-2-1-3-9-17/h1-3,8-9,11-14,16H,4-7,10,15,25H2,(H2,26,28,29,30,31) |
| InChIKey | OSOGYEAMQGKQOS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|