C22H26N6O2 — CID 58881850
1-(4-morpholin-4-ylbutyl)-3-(3-phenylpyrido[2,3-b]pyrazin-6-yl)urea (PubChem CID 58881850) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-(4-morpholin-4-ylbutyl)-3-(3-phenylpyrido[2,3-b]pyrazin-6-yl)urea.
| Compound Name | 1-(4-morpholin-4-ylbutyl)-3-(3-phenylpyrido[2,3-b]pyrazin-6-yl)urea |
|---|---|
| PubChem CID | 58881850 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 1-(4-morpholin-4-ylbutyl)-3-(3-phenylpyrido[2,3-b]pyrazin-6-yl)urea |
| SMILES | O=C(NCCCCN1CCOCC1)Nc1ccc2ncc(-c3ccccc3)nc2n1 |
| InChI | InChI=1S/C22H26N6O2/c29-22(23-10-4-5-11-28-12-14-30-15-13-28)27-20-9-8-18-21(26-20)25-19(16-24-18)17-6-2-1-3-7-17/h1-3,6-9,16H,4-5,10-15H2,(H2,23,25,26,27,29) |
| InChIKey | KVVAPWSFHBIEEJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|