C23H26N6O3S — CID 88994442
3-[3-[4-(2-morpholin-4-ylethoxy)phenyl]pyrido[2,3-b]pyrazin-6-yl]-1-prop-2-enyl-1-sulfanylurea (PubChem CID 88994442) has the molecular formula C23H26N6O3S and a molecular weight of 466.57 g/mol. Its IUPAC name is 3-[3-[4-(2-morpholin-4-ylethoxy)phenyl]pyrido[2,3-b]pyrazin-6-yl]-1-prop-2-enyl-1-sulfanylurea.
| Compound Name | 3-[3-[4-(2-morpholin-4-ylethoxy)phenyl]pyrido[2,3-b]pyrazin-6-yl]-1-prop-2-enyl-1-sulfanylurea |
|---|---|
| PubChem CID | 88994442 |
| Molecular Formula | C23H26N6O3S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 3-[3-[4-(2-morpholin-4-ylethoxy)phenyl]pyrido[2,3-b]pyrazin-6-yl]-1-prop-2-enyl-1-sulfanylurea |
| SMILES | C=CCN(S)C(=O)Nc1ccc2ncc(-c3ccc(OCCN4CCOCC4)cc3)nc2n1 |
| InChI | InChI=1S/C23H26N6O3S/c1-2-9-29(33)23(30)27-21-8-7-19-22(26-21)25-20(16-24-19)17-3-5-18(6-4-17)32-15-12-28-10-13-31-14-11-28/h2-8,16,33H,1,9-15H2,(H,25,26,27,30) |
| InChIKey | PNCMDDVRYQMZNS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|