C18H27N5O10S4 — CID 21110252
methanesulfonic acid;6-[4-(2-morpholin-4-ylethoxy)phenyl]imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide (PubChem CID 21110252) has the molecular formula C18H27N5O10S4 and a molecular weight of 601.71 g/mol. Its IUPAC name is methanesulfonic acid;6-[4-(2-morpholin-4-ylethoxy)phenyl]imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide.
| Compound Name | methanesulfonic acid;6-[4-(2-morpholin-4-ylethoxy)phenyl]imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 21110252 |
| Molecular Formula | C18H27N5O10S4 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.06 |
| IUPAC Name | methanesulfonic acid;6-[4-(2-morpholin-4-ylethoxy)phenyl]imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.NS(=O)(=O)c1nn2cc(-c3ccc(OCCN4CCOCC4)cc3)nc2s1 |
| InChI | InChI=1S/C16H19N5O4S2.2CH4O3S/c17-27(22,23)16-19-21-11-14(18-15(21)26-16)12-1-3-13(4-2-12)25-10-7-20-5-8-24-9-6-20;2*1-5(2,3)4/h1-4,11H,5-10H2,(H2,17,22,23);2*1H3,(H,2,3,4) |
| InChIKey | SEBUBUBQEZSFLP-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 220.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|