C18H25N7O2S — CID 67221495
N-(2-methoxyethyl)-6-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 67221495) has the molecular formula C18H25N7O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is N-(2-methoxyethyl)-6-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | N-(2-methoxyethyl)-6-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 67221495 |
| Molecular Formula | C18H25N7O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-(2-methoxyethyl)-6-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | COCCNc1nn2cc(-c3ccc(NCCN4CCOCC4)nc3)nc2s1 |
| InChI | InChI=1S/C18H25N7O2S/c1-26-9-5-20-17-23-25-13-15(22-18(25)28-17)14-2-3-16(21-12-14)19-4-6-24-7-10-27-11-8-24/h2-3,12-13H,4-11H2,1H3,(H,19,21)(H,20,23) |
| InChIKey | HAXDLWNCYLSYGC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|