C19H22N5O7P — CID 142764045
4-[[3-(4-hydroxy-3-methoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]carbamoylamino]butyl dihydrogen phosphate (PubChem CID 142764045) has the molecular formula C19H22N5O7P and a molecular weight of 463.39 g/mol. Its IUPAC name is 4-[[3-(4-hydroxy-3-methoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]carbamoylamino]butyl dihydrogen phosphate.
| Compound Name | 4-[[3-(4-hydroxy-3-methoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]carbamoylamino]butyl dihydrogen phosphate |
|---|---|
| PubChem CID | 142764045 |
| Molecular Formula | C19H22N5O7P |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 4-[[3-(4-hydroxy-3-methoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]carbamoylamino]butyl dihydrogen phosphate |
| SMILES | COc1cc(-c2cnc3ccc(NC(=O)NCCCCOP(=O)(O)O)nc3n2)ccc1O |
| InChI | InChI=1S/C19H22N5O7P/c1-30-16-10-12(4-6-15(16)25)14-11-21-13-5-7-17(23-18(13)22-14)24-19(26)20-8-2-3-9-31-32(27,28)29/h4-7,10-11,25H,2-3,8-9H2,1H3,(H2,27,28,29)(H2,20,22,23,24,26) |
| InChIKey | ZLPCOOOOWIBIBS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 176.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|