C25H27N5O2 — CID 163875665
1-[3-(4-hydroxyphenyl)pyrido[2,3-b]pyrazin-6-yl]-3-[4-(5-methylcyclohexa-1,3-dien-1-yl)butyl]urea (PubChem CID 163875665) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-[3-(4-hydroxyphenyl)pyrido[2,3-b]pyrazin-6-yl]-3-[4-(5-methylcyclohexa-1,3-dien-1-yl)butyl]urea.
| Compound Name | 1-[3-(4-hydroxyphenyl)pyrido[2,3-b]pyrazin-6-yl]-3-[4-(5-methylcyclohexa-1,3-dien-1-yl)butyl]urea |
|---|---|
| PubChem CID | 163875665 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 1-[3-(4-hydroxyphenyl)pyrido[2,3-b]pyrazin-6-yl]-3-[4-(5-methylcyclohexa-1,3-dien-1-yl)butyl]urea |
| SMILES | CC1C=CC=C(CCCCNC(=O)Nc2ccc3ncc(-c4ccc(O)cc4)nc3n2)C1 |
| InChI | InChI=1S/C25H27N5O2/c1-17-5-4-7-18(15-17)6-2-3-14-26-25(32)30-23-13-12-21-24(29-23)28-22(16-27-21)19-8-10-20(31)11-9-19/h4-5,7-13,16-17,31H,2-3,6,14-15H2,1H3,(H2,26,28,29,30,32) |
| InChIKey | POQHOUGQQFMHAD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|