C27H29N5O4 — CID 66556954
1-(4-phenylbutyl)-3-[3-(2,3,4-trimethoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 66556954) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is 1-(4-phenylbutyl)-3-[3-(2,3,4-trimethoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | 1-(4-phenylbutyl)-3-[3-(2,3,4-trimethoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 66556954 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 1-(4-phenylbutyl)-3-[3-(2,3,4-trimethoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | COc1ccc(-c2cnc3ccc(NC(=O)NCCCCc4ccccc4)nc3n2)c(OC)c1OC |
| InChI | InChI=1S/C27H29N5O4/c1-34-22-14-12-19(24(35-2)25(22)36-3)21-17-29-20-13-15-23(31-26(20)30-21)32-27(33)28-16-8-7-11-18-9-5-4-6-10-18/h4-6,9-10,12-15,17H,7-8,11,16H2,1-3H3,(H2,28,30,31,32,33) |
| InChIKey | FQYZTDKNDREMPV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|