C29H33F2N5O — CID 162558690
1-[3-[3-(4,4-difluorobutyl)-5-methylcyclohexa-1,5-dien-1-yl]pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea (PubChem CID 162558690) has the molecular formula C29H33F2N5O and a molecular weight of 505.61 g/mol. Its IUPAC name is 1-[3-[3-(4,4-difluorobutyl)-5-methylcyclohexa-1,5-dien-1-yl]pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea.
| Compound Name | 1-[3-[3-(4,4-difluorobutyl)-5-methylcyclohexa-1,5-dien-1-yl]pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 162558690 |
| Molecular Formula | C29H33F2N5O |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | 1-[3-[3-(4,4-difluorobutyl)-5-methylcyclohexa-1,5-dien-1-yl]pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea |
| SMILES | CC1=CC(c2cnc3ccc(NC(=O)NCCCCc4ccccc4)nc3n2)=CC(CCCC(F)F)C1 |
| InChI | InChI=1S/C29H33F2N5O/c1-20-16-22(11-7-12-26(30)31)18-23(17-20)25-19-33-24-13-14-27(35-28(24)34-25)36-29(37)32-15-6-5-10-21-8-3-2-4-9-21/h2-4,8-9,13-14,17-19,22,26H,5-7,10-12,15-16H2,1H3,(H2,32,34,35,36,37) |
| InChIKey | JHZLDMOSLILPPO-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|