C21H23N5O6 — CID 16727340
[4-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]-2-methoxyphenyl] 2-methoxyethyl carbonate (PubChem CID 16727340) has the molecular formula C21H23N5O6 and a molecular weight of 441.44 g/mol. Its IUPAC name is [4-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]-2-methoxyphenyl] 2-methoxyethyl carbonate.
| Compound Name | [4-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]-2-methoxyphenyl] 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 16727340 |
| Molecular Formula | C21H23N5O6 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | [4-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]-2-methoxyphenyl] 2-methoxyethyl carbonate |
| SMILES | CCNC(=O)Nc1ccc2ncc(-c3ccc(OC(=O)OCCOC)c(OC)c3)nc2n1 |
| InChI | InChI=1S/C21H23N5O6/c1-4-22-20(27)26-18-8-6-14-19(25-18)24-15(12-23-14)13-5-7-16(17(11-13)30-3)32-21(28)31-10-9-29-2/h5-8,11-12H,4,9-10H2,1-3H3,(H2,22,24,25,26,27) |
| InChIKey | YIVZRFNNTVBZCO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|