C26H27N5O8S — CID 16727371
benzenesulfonic acid;[4-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate (PubChem CID 16727371) has the molecular formula C26H27N5O8S and a molecular weight of 569.60 g/mol. Its IUPAC name is benzenesulfonic acid;[4-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate.
| Compound Name | benzenesulfonic acid;[4-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 16727371 |
| Molecular Formula | C26H27N5O8S |
| Molecular Weight | 569.60 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | benzenesulfonic acid;[4-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate |
| SMILES | CCNC(=O)Nc1ccc2ncc(-c3ccc(OC(=O)OCCOC)cc3)nc2n1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C20H21N5O5.C6H6O3S/c1-3-21-19(26)25-17-9-8-15-18(24-17)23-16(12-22-15)13-4-6-14(7-5-13)30-20(27)29-11-10-28-2;7-10(8,9)6-4-2-1-3-5-6/h4-9,12H,3,10-11H2,1-2H3,(H2,21,23,24,25,26);1-5H,(H,7,8,9) |
| InChIKey | DGAWUGGXLJZRCA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 178.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|