C18H19N5O — CID 16730273
1,1-diethyl-3-(3-phenylpyrido[2,3-b]pyrazin-6-yl)urea (PubChem CID 16730273) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 1,1-diethyl-3-(3-phenylpyrido[2,3-b]pyrazin-6-yl)urea.
| Compound Name | 1,1-diethyl-3-(3-phenylpyrido[2,3-b]pyrazin-6-yl)urea |
|---|---|
| PubChem CID | 16730273 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1,1-diethyl-3-(3-phenylpyrido[2,3-b]pyrazin-6-yl)urea |
| SMILES | CCN(CC)C(=O)Nc1ccc2ncc(-c3ccccc3)nc2n1 |
| InChI | InChI=1S/C18H19N5O/c1-3-23(4-2)18(24)22-16-11-10-14-17(21-16)20-15(12-19-14)13-8-6-5-7-9-13/h5-12H,3-4H2,1-2H3,(H,20,21,22,24) |
| InChIKey | KTFQTDQQMLQGPI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |