C20H21N5O3 — CID 91559493
3-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]hexanoic acid (PubChem CID 91559493) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 3-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]hexanoic acid.
| Compound Name | 3-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 91559493 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-[(3-phenylpyrido[2,3-b]pyrazin-6-yl)carbamoylamino]hexanoic acid |
| SMILES | CCCC(CC(=O)O)NC(=O)Nc1ccc2ncc(-c3ccccc3)nc2n1 |
| InChI | InChI=1S/C20H21N5O3/c1-2-6-14(11-18(26)27)22-20(28)25-17-10-9-15-19(24-17)23-16(12-21-15)13-7-4-3-5-8-13/h3-5,7-10,12,14H,2,6,11H2,1H3,(H,26,27)(H2,22,23,24,25,28) |
| InChIKey | JPNBLCCYRISCFC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |