C20H21N5O5 — CID 16727165
[3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate (PubChem CID 16727165) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate.
| Compound Name | [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 16727165 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate |
| SMILES | CCNC(=O)Nc1ccc2ncc(-c3cccc(OC(=O)OCCOC)c3)nc2n1 |
| InChI | InChI=1S/C20H21N5O5/c1-3-21-19(26)25-17-8-7-15-18(24-17)23-16(12-22-15)13-5-4-6-14(11-13)30-20(27)29-10-9-28-2/h4-8,11-12H,3,9-10H2,1-2H3,(H2,21,23,24,25,26) |
| InChIKey | DMIJNYFCOCQHRX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|