About [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate
[3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate (PubChem CID 16727165) has the molecular formula C20H21N5O5
and a molecular weight of 411.42 g/mol. Its IUPAC name is [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate.
Molecular Properties
| Compound Name | [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate |
| PubChem CID | 16727165 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate |
| SMILES | CCNC(=O)Nc1ccc2ncc(-c3cccc(OC(=O)OCCOC)c3)nc2n1 |
| InChI | InChI=1S/C20H21N5O5/c1-3-21-19(26)25-17-8-7-15-18(24-17)23-16(12-22-15)13-5-4-6-14(11-13)30-20(27)29-10-9-28-2/h4-8,11-12H,3,9-10H2,1-2H3,(H2,21,23,24,25,26) |
| InChIKey | DMIJNYFCOCQHRX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate?
The IUPAC name of [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate (CID 16727165) is [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate.
What is the SMILES notation for [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate?
The canonical SMILES for [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate is CCNC(=O)Nc1ccc2ncc(-c3cccc(OC(=O)OCCOC)c3)nc2n1.
What is the InChIKey of [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate?
The InChIKey is DMIJNYFCOCQHRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N5O5/c1-3-21-19(26)25-17-8-7-15-18(24-17)23-16(12-22-15)13-5-4-6-14(11-13)30-20(27)29-10-9-28-2/h4-8,11-12H,3,9-10H2,1-2H3,(H2,21,23,24,25,26).
What are the key properties of [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate?
[3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate has a molecular weight of 411.42 g/mol, XLogP of 2.99, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl] 2-methoxyethyl carbonate is sourced from PubChem (CID 16727165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).