C21H20N6O — CID 90164299
1-(3-phenylpropyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea (PubChem CID 90164299) has the molecular formula C21H20N6O and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-(3-phenylpropyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea.
| Compound Name | 1-(3-phenylpropyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea |
|---|---|
| PubChem CID | 90164299 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-(3-phenylpropyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea |
| SMILES | O=C(NCCCc1ccccc1)Nc1ccc2ncc(-c3cn[nH]c3)cc2n1 |
| InChI | InChI=1S/C21H20N6O/c28-21(22-10-4-7-15-5-2-1-3-6-15)27-20-9-8-18-19(26-20)11-16(12-23-18)17-13-24-25-14-17/h1-3,5-6,8-9,11-14H,4,7,10H2,(H,24,25)(H2,22,26,27,28) |
| InChIKey | HULCSWTXMBEARO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|