C22H19N7O — CID 90164317
1-[2-(1H-indol-3-yl)ethyl]-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea (PubChem CID 90164317) has the molecular formula C22H19N7O and a molecular weight of 397.44 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea |
|---|---|
| PubChem CID | 90164317 |
| Molecular Formula | C22H19N7O |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)Nc1ccc2ncc(-c3cn[nH]c3)cc2n1 |
| InChI | InChI=1S/C22H19N7O/c30-22(23-8-7-14-10-24-18-4-2-1-3-17(14)18)29-21-6-5-19-20(28-21)9-15(11-25-19)16-12-26-27-13-16/h1-6,9-13,24H,7-8H2,(H,26,27)(H2,23,28,29,30) |
| InChIKey | BUQCNAAHEXAFKH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |