C24H20Cl2N4O2 — CID 135908248
1-[7-(3,5-dichloro-4-hydroxyphenyl)quinoxalin-2-yl]-3-(3-phenylpropyl)urea (PubChem CID 135908248) has the molecular formula C24H20Cl2N4O2 and a molecular weight of 467.36 g/mol. Its IUPAC name is 1-[7-(3,5-dichloro-4-hydroxyphenyl)quinoxalin-2-yl]-3-(3-phenylpropyl)urea.
| Compound Name | 1-[7-(3,5-dichloro-4-hydroxyphenyl)quinoxalin-2-yl]-3-(3-phenylpropyl)urea |
|---|---|
| PubChem CID | 135908248 |
| Molecular Formula | C24H20Cl2N4O2 |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 1-[7-(3,5-dichloro-4-hydroxyphenyl)quinoxalin-2-yl]-3-(3-phenylpropyl)urea |
| SMILES | O=C(NCCCc1ccccc1)Nc1cnc2ccc(-c3cc(Cl)c(O)c(Cl)c3)cc2n1 |
| InChI | InChI=1S/C24H20Cl2N4O2/c25-18-11-17(12-19(26)23(18)31)16-8-9-20-21(13-16)29-22(14-28-20)30-24(32)27-10-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-9,11-14,31H,4,7,10H2,(H2,27,29,30,32) |
| InChIKey | GOOZBPXTFXNJHJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|