C20H22N4O2 — CID 135908217
1-[7-(4-hydroxy-3,5-dimethylphenyl)quinoxalin-2-yl]-3-propylurea (PubChem CID 135908217) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-[7-(4-hydroxy-3,5-dimethylphenyl)quinoxalin-2-yl]-3-propylurea.
| Compound Name | 1-[7-(4-hydroxy-3,5-dimethylphenyl)quinoxalin-2-yl]-3-propylurea |
|---|---|
| PubChem CID | 135908217 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-[7-(4-hydroxy-3,5-dimethylphenyl)quinoxalin-2-yl]-3-propylurea |
| SMILES | CCCNC(=O)Nc1cnc2ccc(-c3cc(C)c(O)c(C)c3)cc2n1 |
| InChI | InChI=1S/C20H22N4O2/c1-4-7-21-20(26)24-18-11-22-16-6-5-14(10-17(16)23-18)15-8-12(2)19(25)13(3)9-15/h5-6,8-11,25H,4,7H2,1-3H3,(H2,21,23,24,26) |
| InChIKey | CPLAEELJDGYJTE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |