C25H22N4O3 — CID 135908220
1-(3-acetylphenyl)-3-[7-(4-hydroxy-3,5-dimethylphenyl)quinoxalin-2-yl]urea (PubChem CID 135908220) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[7-(4-hydroxy-3,5-dimethylphenyl)quinoxalin-2-yl]urea.
| Compound Name | 1-(3-acetylphenyl)-3-[7-(4-hydroxy-3,5-dimethylphenyl)quinoxalin-2-yl]urea |
|---|---|
| PubChem CID | 135908220 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[7-(4-hydroxy-3,5-dimethylphenyl)quinoxalin-2-yl]urea |
| SMILES | CC(=O)c1cccc(NC(=O)Nc2cnc3ccc(-c4cc(C)c(O)c(C)c4)cc3n2)c1 |
| InChI | InChI=1S/C25H22N4O3/c1-14-9-19(10-15(2)24(14)31)18-7-8-21-22(12-18)28-23(13-26-21)29-25(32)27-20-6-4-5-17(11-20)16(3)30/h4-13,31H,1-3H3,(H2,27,28,29,32) |
| InChIKey | XVCXEVMSMWLQQC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |