C14H19N3O3 — CID 60609638
1-(3-acetylphenyl)-3-(2,2-dimethylpropanoylamino)urea (PubChem CID 60609638) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-(2,2-dimethylpropanoylamino)urea.
| Compound Name | 1-(3-acetylphenyl)-3-(2,2-dimethylpropanoylamino)urea |
|---|---|
| PubChem CID | 60609638 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 1-(3-acetylphenyl)-3-(2,2-dimethylpropanoylamino)urea |
| SMILES | CC(=O)c1cccc(NC(=O)NNC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H19N3O3/c1-9(18)10-6-5-7-11(8-10)15-13(20)17-16-12(19)14(2,3)4/h5-8H,1-4H3,(H,16,19)(H2,15,17,20) |
| InChIKey | YODIUJGUUCOEBZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|