C18H20N6O2 — CID 58881846
1-ethyl-3-[3-(3-methoxy-4-methylanilino)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 58881846) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-methoxy-4-methylanilino)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | 1-ethyl-3-[3-(3-methoxy-4-methylanilino)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 58881846 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-ethyl-3-[3-(3-methoxy-4-methylanilino)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | CCNC(=O)Nc1ccc2ncc(Nc3ccc(C)c(OC)c3)nc2n1 |
| InChI | InChI=1S/C18H20N6O2/c1-4-19-18(25)24-15-8-7-13-17(22-15)23-16(10-20-13)21-12-6-5-11(2)14(9-12)26-3/h5-10H,4H2,1-3H3,(H3,19,21,22,23,24,25) |
| InChIKey | YBERBXAVYCSDAR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |