C19H22N6O5S — CID 87656311
1-(methoxymethyl)-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 87656311) has the molecular formula C19H22N6O5S and a molecular weight of 446.49 g/mol. Its IUPAC name is 1-(methoxymethyl)-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | 1-(methoxymethyl)-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 87656311 |
| Molecular Formula | C19H22N6O5S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 1-(methoxymethyl)-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | COCN(S)C(=O)Nc1ccc2ncc(Nc3cc(OC)c(OC)c(OC)c3)nc2n1 |
| InChI | InChI=1S/C19H22N6O5S/c1-27-10-25(31)19(26)24-15-6-5-12-18(22-15)23-16(9-20-12)21-11-7-13(28-2)17(30-4)14(8-11)29-3/h5-9,31H,10H2,1-4H3,(H2,21,22,23,24,26) |
| InChIKey | PLSYAXVSRCURTN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|