C23H29N7O4S — CID 140542165
1-(1-hydroxy-2-methylpiperidin-4-yl)-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]thiourea (PubChem CID 140542165) has the molecular formula C23H29N7O4S and a molecular weight of 499.60 g/mol. Its IUPAC name is 1-(1-hydroxy-2-methylpiperidin-4-yl)-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]thiourea.
| Compound Name | 1-(1-hydroxy-2-methylpiperidin-4-yl)-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]thiourea |
|---|---|
| PubChem CID | 140542165 |
| Molecular Formula | C23H29N7O4S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 1-(1-hydroxy-2-methylpiperidin-4-yl)-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]thiourea |
| SMILES | COc1cc(Nc2cnc3ccc(NC(=S)NC4CCN(O)C(C)C4)nc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H29N7O4S/c1-13-9-14(7-8-30(13)31)26-23(35)29-19-6-5-16-22(27-19)28-20(12-24-16)25-15-10-17(32-2)21(34-4)18(11-15)33-3/h5-6,10-14,31H,7-9H2,1-4H3,(H3,25,26,27,28,29,35) |
| InChIKey | NBRNMOSTKPQFLF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|