C24H30N6O4S — CID 87656055
1-(cyclohexylmethyl)-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 87656055) has the molecular formula C24H30N6O4S and a molecular weight of 498.61 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | 1-(cyclohexylmethyl)-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 87656055 |
| Molecular Formula | C24H30N6O4S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 1-(cyclohexylmethyl)-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | COc1cc(Nc2cnc3ccc(NC(=O)N(S)CC4CCCCC4)nc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C24H30N6O4S/c1-32-18-11-16(12-19(33-2)22(18)34-3)26-21-13-25-17-9-10-20(27-23(17)28-21)29-24(31)30(35)14-15-7-5-4-6-8-15/h9-13,15,35H,4-8,14H2,1-3H3,(H2,26,27,28,29,31) |
| InChIKey | BECRMGHJUAUCQX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|