C15H15N7O — CID 58881916
1-ethyl-3-[3-(pyridin-3-ylamino)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 58881916) has the molecular formula C15H15N7O and a molecular weight of 309.33 g/mol. Its IUPAC name is 1-ethyl-3-[3-(pyridin-3-ylamino)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | 1-ethyl-3-[3-(pyridin-3-ylamino)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 58881916 |
| Molecular Formula | C15H15N7O |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-ethyl-3-[3-(pyridin-3-ylamino)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | CCNC(=O)Nc1ccc2ncc(Nc3cccnc3)nc2n1 |
| InChI | InChI=1S/C15H15N7O/c1-2-17-15(23)22-12-6-5-11-14(20-12)21-13(9-18-11)19-10-4-3-7-16-8-10/h3-9H,2H2,1H3,(H3,17,19,20,21,22,23) |
| InChIKey | OYSDFAWPEZXUOW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |