C18H16N8O — CID 58881777
1-ethyl-3-[3-(quinoxalin-6-ylamino)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 58881777) has the molecular formula C18H16N8O and a molecular weight of 360.38 g/mol. Its IUPAC name is 1-ethyl-3-[3-(quinoxalin-6-ylamino)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | 1-ethyl-3-[3-(quinoxalin-6-ylamino)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 58881777 |
| Molecular Formula | C18H16N8O |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-ethyl-3-[3-(quinoxalin-6-ylamino)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | CCNC(=O)Nc1ccc2ncc(Nc3ccc4nccnc4c3)nc2n1 |
| InChI | InChI=1S/C18H16N8O/c1-2-19-18(27)26-15-6-5-13-17(24-15)25-16(10-22-13)23-11-3-4-12-14(9-11)21-8-7-20-12/h3-10H,2H2,1H3,(H3,19,23,24,25,26,27) |
| InChIKey | SCQIQQREQULPRE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |