C26H28N8O — CID 134151089
N-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]purin-9-yl]phenyl]prop-2-enamide (PubChem CID 134151089) has the molecular formula C26H28N8O and a molecular weight of 468.57 g/mol. Its IUPAC name is N-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]purin-9-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]purin-9-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 134151089 |
| Molecular Formula | C26H28N8O |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | N-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]purin-9-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2cnc3cnc(Nc4ccc(N5CCN(CC)CC5)cc4)nc32)c1 |
| InChI | InChI=1S/C26H28N8O/c1-3-24(35)29-20-6-5-7-22(16-20)34-18-28-23-17-27-26(31-25(23)34)30-19-8-10-21(11-9-19)33-14-12-32(4-2)13-15-33/h3,5-11,16-18H,1,4,12-15H2,2H3,(H,29,35)(H,27,30,31) |
| InChIKey | SSWVCXHMCLMGNT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|